C19H17BrN2O4 — CID 55380659
(2-bromo-4-cyano-6-ethoxyphenyl) 4-(acetamidomethyl)benzoate (PubChem CID 55380659) has the molecular formula C19H17BrN2O4 and a molecular weight of 417.26 g/mol. Its IUPAC name is (2-bromo-4-cyano-6-ethoxyphenyl) 4-(acetamidomethyl)benzoate.
| Compound Name | (2-bromo-4-cyano-6-ethoxyphenyl) 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 55380659 |
| Molecular Formula | C19H17BrN2O4 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | (2-bromo-4-cyano-6-ethoxyphenyl) 4-(acetamidomethyl)benzoate |
| SMILES | CCOc1cc(C#N)cc(Br)c1OC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C19H17BrN2O4/c1-3-25-17-9-14(10-21)8-16(20)18(17)26-19(24)15-6-4-13(5-7-15)11-22-12(2)23/h4-9H,3,11H2,1-2H3,(H,22,23) |
| InChIKey | BVPLBZIQANCQIB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|