C18H14BrN3O3 — CID 55332788
(2-bromo-4-cyano-6-ethoxyphenyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 55332788) has the molecular formula C18H14BrN3O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is (2-bromo-4-cyano-6-ethoxyphenyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | (2-bromo-4-cyano-6-ethoxyphenyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 55332788 |
| Molecular Formula | C18H14BrN3O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | (2-bromo-4-cyano-6-ethoxyphenyl) 5-methylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOc1cc(C#N)cc(Br)c1OC(=O)c1cn2c(C)cccc2n1 |
| InChI | InChI=1S/C18H14BrN3O3/c1-3-24-15-8-12(9-20)7-13(19)17(15)25-18(23)14-10-22-11(2)5-4-6-16(22)21-14/h4-8,10H,3H2,1-2H3 |
| InChIKey | KYUPNJHRYLSZBL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|