C18H13BrF3NO3 — CID 18285109
(2-bromo-4-cyano-6-ethoxyphenyl) 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 18285109) has the molecular formula C18H13BrF3NO3 and a molecular weight of 428.20 g/mol. Its IUPAC name is (2-bromo-4-cyano-6-ethoxyphenyl) 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | (2-bromo-4-cyano-6-ethoxyphenyl) 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 18285109 |
| Molecular Formula | C18H13BrF3NO3 |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | (2-bromo-4-cyano-6-ethoxyphenyl) 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOc1cc(C#N)cc(Br)c1OC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13BrF3NO3/c1-2-25-15-8-12(10-23)7-14(19)17(15)26-16(24)9-11-4-3-5-13(6-11)18(20,21)22/h3-8H,2,9H2,1H3 |
| InChIKey | PDNGLKHHCQQSFT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|