C21H18BrNO4 — CID 18274010
(2-bromo-4-cyano-6-ethoxyphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 18274010) has the molecular formula C21H18BrNO4 and a molecular weight of 428.28 g/mol. Its IUPAC name is (2-bromo-4-cyano-6-ethoxyphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate.
| Compound Name | (2-bromo-4-cyano-6-ethoxyphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 18274010 |
| Molecular Formula | C21H18BrNO4 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (2-bromo-4-cyano-6-ethoxyphenyl) 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | CCOc1cc(C#N)cc(Br)c1OC(=O)Cc1coc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C21H18BrNO4/c1-4-25-19-8-14(10-23)7-17(22)21(19)27-20(24)9-15-11-26-18-6-13(3)12(2)5-16(15)18/h5-8,11H,4,9H2,1-3H3 |
| InChIKey | CIHPSBKFFGQWOP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 72.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|