C9H9Cl2NO — CID 18425630
N-[(3,5-dichlorophenyl)methyl]acetamide (PubChem CID 18425630) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]acetamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 18425630 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]acetamide |
| SMILES | CC(=O)NCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO/c1-6(13)12-5-7-2-8(10)4-9(11)3-7/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | JBMPIMXRRSZVJX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |