C17H15Cl3O2 — CID 91723724
(2,4,6-trichlorophenyl) 4-butylbenzoate (PubChem CID 91723724) has the molecular formula C17H15Cl3O2 and a molecular weight of 357.66 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 4-butylbenzoate.
| Compound Name | (2,4,6-trichlorophenyl) 4-butylbenzoate |
|---|---|
| PubChem CID | 91723724 |
| Molecular Formula | C17H15Cl3O2 |
| Molecular Weight | 357.66 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | (2,4,6-trichlorophenyl) 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl3O2/c1-2-3-4-11-5-7-12(8-6-11)17(21)22-16-14(19)9-13(18)10-15(16)20/h5-10H,2-4H2,1H3 |
| InChIKey | RIJKZQOBPHGURK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|