C21H21Cl3O4 — CID 91738452
1-O-heptyl 3-O-(2,4,6-trichlorophenyl) benzene-1,3-dicarboxylate (PubChem CID 91738452) has the molecular formula C21H21Cl3O4 and a molecular weight of 443.75 g/mol. Its IUPAC name is 1-O-heptyl 3-O-(2,4,6-trichlorophenyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-heptyl 3-O-(2,4,6-trichlorophenyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91738452 |
| Molecular Formula | C21H21Cl3O4 |
| Molecular Weight | 443.75 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 1-O-heptyl 3-O-(2,4,6-trichlorophenyl) benzene-1,3-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1cccc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H21Cl3O4/c1-2-3-4-5-6-10-27-20(25)14-8-7-9-15(11-14)21(26)28-19-17(23)12-16(22)13-18(19)24/h7-9,11-13H,2-6,10H2,1H3 |
| InChIKey | NCMAMLIQDGCWLP-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.75 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|