C20H19Cl3O4 — CID 91736996
1-O-hexyl 3-O-(2,4,5-trichlorophenyl) benzene-1,3-dicarboxylate (PubChem CID 91736996) has the molecular formula C20H19Cl3O4 and a molecular weight of 429.73 g/mol. Its IUPAC name is 1-O-hexyl 3-O-(2,4,5-trichlorophenyl) benzene-1,3-dicarboxylate.
| Compound Name | 1-O-hexyl 3-O-(2,4,5-trichlorophenyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91736996 |
| Molecular Formula | C20H19Cl3O4 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 1-O-hexyl 3-O-(2,4,5-trichlorophenyl) benzene-1,3-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1cccc(C(=O)Oc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H19Cl3O4/c1-2-3-4-5-9-26-19(24)13-7-6-8-14(10-13)20(25)27-18-12-16(22)15(21)11-17(18)23/h6-8,10-12H,2-5,9H2,1H3 |
| InChIKey | AENYJRIXEMXWNJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|