C13H16N2O4 — CID 18195544
[2-(methylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate (PubChem CID 18195544) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 18195544 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-(acetamidomethyl)benzoate |
| SMILES | CNC(=O)COC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C13H16N2O4/c1-9(16)15-7-10-3-5-11(6-4-10)13(18)19-8-12(17)14-2/h3-6H,7-8H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | VCZMXZVFXZVLNF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |