C23H26N2O4S — CID 3036622
naphthalen-2-yl (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 3036622) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is naphthalen-2-yl (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | naphthalen-2-yl (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3036622 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | naphthalen-2-yl (2S)-6-amino-2-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCCCN)C(=O)Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-17-9-13-21(14-10-17)30(27,28)25-22(8-4-5-15-24)23(26)29-20-12-11-18-6-2-3-7-19(18)16-20/h2-3,6-7,9-14,16,22,25H,4-5,8,15,24H2,1H3/t22-/m0/s1 |
| InChIKey | ZQPNYVYPUPHKFE-QFIPXVFZSA-N |
| XLogP | 3.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|