C21H21NO5S — CID 70347899
naphthalen-2-yloxymethyl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 70347899) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is naphthalen-2-yloxymethyl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | naphthalen-2-yloxymethyl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 70347899 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | naphthalen-2-yloxymethyl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)OCOc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C21H21NO5S/c1-15-7-11-20(12-8-15)28(24,25)22-16(2)21(23)27-14-26-19-10-9-17-5-3-4-6-18(17)13-19/h3-13,16,22H,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | CKPWNJCRORTHJM-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|