C16H24N2O5S — CID 16565546
[2-(diethylamino)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 16565546) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 16565546 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | CCN(CC)C(=O)COC(=O)[C@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H24N2O5S/c1-5-18(6-2)15(19)11-23-16(20)13(4)17-24(21,22)14-9-7-12(3)8-10-14/h7-10,13,17H,5-6,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | SZTIUOSJTNSCFO-ZDUSSCGKSA-N |
| XLogP | 1.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |