C16H26N2O4S — CID 171317631
2-[4-(butan-2-ylsulfamoyl)phenoxy]-N,N-diethylacetamide (PubChem CID 171317631) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[4-(butan-2-ylsulfamoyl)phenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[4-(butan-2-ylsulfamoyl)phenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 171317631 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[4-(butan-2-ylsulfamoyl)phenoxy]-N,N-diethylacetamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(OCC(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C16H26N2O4S/c1-5-13(4)17-23(20,21)15-10-8-14(9-11-15)22-12-16(19)18(6-2)7-3/h8-11,13,17H,5-7,12H2,1-4H3 |
| InChIKey | QVLBVAAEIODKFE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |