C18H26N2O7S — CID 16565565
ethyl 4-[[2-[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]butanoate (PubChem CID 16565565) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is ethyl 4-[[2-[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]butanoate |
|---|---|
| PubChem CID | 16565565 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl 4-[[2-[(2S)-2-[(4-methylphenyl)sulfonylamino]propanoyl]oxyacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)[C@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H26N2O7S/c1-4-26-17(22)6-5-11-19-16(21)12-27-18(23)14(3)20-28(24,25)15-9-7-13(2)8-10-15/h7-10,14,20H,4-6,11-12H2,1-3H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | LWNSRUZSWCFEDK-AWEZNQCLSA-N |
| XLogP | 0.66 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|