C18H27BrN2O6S — CID 42971718
[2-(3-ethoxypropylamino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 42971718) has the molecular formula C18H27BrN2O6S and a molecular weight of 479.39 g/mol. Its IUPAC name is [2-(3-ethoxypropylamino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [2-(3-ethoxypropylamino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 42971718 |
| Molecular Formula | C18H27BrN2O6S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | [2-(3-ethoxypropylamino)-2-oxoethyl] 2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CCOCCCNC(=O)COC(=O)C(NS(=O)(=O)c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C18H27BrN2O6S/c1-4-26-11-5-10-20-16(22)12-27-18(23)17(13(2)3)21-28(24,25)15-8-6-14(19)7-9-15/h6-9,13,17,21H,4-5,10-12H2,1-3H3,(H,20,22) |
| InChIKey | GMAPAEFOAUAWDJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|