C20H20BrN3O5S — CID 55927172
[2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55927172) has the molecular formula C20H20BrN3O5S and a molecular weight of 494.37 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55927172 |
| Molecular Formula | C20H20BrN3O5S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)OCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H20BrN3O5S/c1-13(2)19(24-30(27,28)17-8-6-15(21)7-9-17)20(26)29-12-18(25)23-16-5-3-4-14(10-16)11-22/h3-10,13,19,24H,12H2,1-2H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | LEPLIKXERDABOQ-IBGZPJMESA-N |
| XLogP | 2.81 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |