C16H16ClNO5S2 — CID 8843793
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 8843793) has the molecular formula C16H16ClNO5S2 and a molecular weight of 401.89 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8843793 |
| Molecular Formula | C16H16ClNO5S2 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)OCC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C16H16ClNO5S2/c1-10-3-5-12(6-4-10)25(21,22)18-11(2)16(20)23-9-13(19)14-7-8-15(17)24-14/h3-8,11,18H,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | BCDIEODRIZSBIJ-NSHDSACASA-N |
| XLogP | 2.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |