C17H14F5NO4S — CID 42902975
(2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 42902975) has the molecular formula C17H14F5NO4S and a molecular weight of 423.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42902975 |
| Molecular Formula | C17H14F5NO4S |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F5NO4S/c1-8-3-5-10(6-4-8)28(25,26)23-9(2)17(24)27-7-11-12(18)14(20)16(22)15(21)13(11)19/h3-6,9,23H,7H2,1-2H3 |
| InChIKey | RNCXIXHKBFTHLR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|