C24H28N2O6S2 — CID 74225288
methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-6-(naphthalen-2-ylsulfonylamino)hexanoate (PubChem CID 74225288) has the molecular formula C24H28N2O6S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-6-(naphthalen-2-ylsulfonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-6-(naphthalen-2-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 74225288 |
| Molecular Formula | C24H28N2O6S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | methyl (2S)-2-[(4-methylphenyl)sulfonylamino]-6-(naphthalen-2-ylsulfonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNS(=O)(=O)c1ccc2ccccc2c1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O6S2/c1-18-10-13-21(14-11-18)34(30,31)26-23(24(27)32-2)9-5-6-16-25-33(28,29)22-15-12-19-7-3-4-8-20(19)17-22/h3-4,7-8,10-15,17,23,25-26H,5-6,9,16H2,1-2H3/t23-/m0/s1 |
| InChIKey | JVCGHDVXCUIUHJ-QHCPKHFHSA-N |
| XLogP | 3.12 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|