C20H25NO4S — CID 3263184
methyl 3-cyclohexyl-2-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 3263184) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | methyl 3-cyclohexyl-2-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 3263184 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl 3-cyclohexyl-2-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | COC(=O)C(CC1CCCCC1)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H25NO4S/c1-25-20(22)19(13-15-7-3-2-4-8-15)21-26(23,24)18-12-11-16-9-5-6-10-17(16)14-18/h5-6,9-12,14-15,19,21H,2-4,7-8,13H2,1H3 |
| InChIKey | XKDYRMWDZWGBBC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |