C16H22BrNO4S — CID 74227202
methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-cyclohexylpropanoate (PubChem CID 74227202) has the molecular formula C16H22BrNO4S and a molecular weight of 404.33 g/mol. Its IUPAC name is methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-cyclohexylpropanoate.
| Compound Name | methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 74227202 |
| Molecular Formula | C16H22BrNO4S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-cyclohexylpropanoate |
| SMILES | COC(=O)[C@H](CC1CCCCC1)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrNO4S/c1-22-16(19)15(11-12-5-3-2-4-6-12)18-23(20,21)14-9-7-13(17)8-10-14/h7-10,12,15,18H,2-6,11H2,1H3/t15-/m0/s1 |
| InChIKey | VGZFCWOWRFPGFQ-HNNXBMFYSA-N |
| XLogP | 3.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |