C21H24BrNO5S — CID 91120603
methyl (2R)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-2-(4-hydroxycyclohexyl)acetate (PubChem CID 91120603) has the molecular formula C21H24BrNO5S and a molecular weight of 482.40 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-2-(4-hydroxycyclohexyl)acetate.
| Compound Name | methyl (2R)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-2-(4-hydroxycyclohexyl)acetate |
|---|---|
| PubChem CID | 91120603 |
| Molecular Formula | C21H24BrNO5S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | methyl (2R)-2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-2-(4-hydroxycyclohexyl)acetate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1)C1CCC(O)CC1 |
| InChI | InChI=1S/C21H24BrNO5S/c1-28-21(25)20(16-4-10-18(24)11-5-16)23-29(26,27)19-12-6-15(7-13-19)14-2-8-17(22)9-3-14/h2-3,6-9,12-13,16,18,20,23-24H,4-5,10-11H2,1H3/t16?,18?,20-/m1/s1 |
| InChIKey | RYYKYAPLTDQAGU-OUNSHVDWSA-N |
| XLogP | 3.49 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |