C21H26BrNO4S — CID 70212133
tert-butyl 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoate (PubChem CID 70212133) has the molecular formula C21H26BrNO4S and a molecular weight of 468.41 g/mol. Its IUPAC name is tert-butyl 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoate.
| Compound Name | tert-butyl 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 70212133 |
| Molecular Formula | C21H26BrNO4S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | tert-butyl 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26BrNO4S/c1-14(2)19(20(24)27-21(3,4)5)23-28(25,26)18-12-8-16(9-13-18)15-6-10-17(22)11-7-15/h6-14,19,23H,1-5H3 |
| InChIKey | WIZHTLZRNBDNDS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |