C15H24N2O4S — CID 10496531
tert-butyl (2R)-2-[(4-aminophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 10496531) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-aminophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[(4-aminophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10496531 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | tert-butyl (2R)-2-[(4-aminophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc(N)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-10(2)13(14(18)21-15(3,4)5)17-22(19,20)12-8-6-11(16)7-9-12/h6-10,13,17H,16H2,1-5H3/t13-/m1/s1 |
| InChIKey | JHFAMPSIHYGYFB-CYBMUJFWSA-N |
| XLogP | 1.91 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|