C16H26N2O4S — CID 59461671
tert-butyl (2S)-2-[[2-(aminomethyl)phenyl]sulfonylamino]-3-methylbutanoate (PubChem CID 59461671) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(aminomethyl)phenyl]sulfonylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[2-(aminomethyl)phenyl]sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 59461671 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(aminomethyl)phenyl]sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccccc1CN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O4S/c1-11(2)14(15(19)22-16(3,4)5)18-23(20,21)13-9-7-6-8-12(13)10-17/h6-9,11,14,18H,10,17H2,1-5H3/t14-/m0/s1 |
| InChIKey | ZFGOBKPDRLHBSB-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |