C14H28N2O8S2 — CID 102512584
ditert-butyl (2S,3R)-2,3-bis(methanesulfonamido)butanedioate (PubChem CID 102512584) has the molecular formula C14H28N2O8S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is ditert-butyl (2S,3R)-2,3-bis(methanesulfonamido)butanedioate.
| Compound Name | ditert-butyl (2S,3R)-2,3-bis(methanesulfonamido)butanedioate |
|---|---|
| PubChem CID | 102512584 |
| Molecular Formula | C14H28N2O8S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | ditert-butyl (2S,3R)-2,3-bis(methanesulfonamido)butanedioate |
| SMILES | CC(C)(C)OC(=O)[C@@H](NS(C)(=O)=O)[C@@H](NS(C)(=O)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O8S2/c1-13(2,3)23-11(17)9(15-25(7,19)20)10(16-26(8,21)22)12(18)24-14(4,5)6/h9-10,15-16H,1-8H3/t9-,10+ |
| InChIKey | MLWJLHLBDLQGRY-AOOOYVTPSA-N |
| XLogP | -0.49 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |