C11H23NO3 — CID 134164851
tert-butyl (2S,3R)-3-hydroxy-2-(propan-2-ylamino)butanoate (PubChem CID 134164851) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-hydroxy-2-(propan-2-ylamino)butanoate.
| Compound Name | tert-butyl (2S,3R)-3-hydroxy-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 134164851 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | tert-butyl (2S,3R)-3-hydroxy-2-(propan-2-ylamino)butanoate |
| SMILES | CC(C)N[C@H](C(=O)OC(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C11H23NO3/c1-7(2)12-9(8(3)13)10(14)15-11(4,5)6/h7-9,12-13H,1-6H3/t8-,9+/m1/s1 |
| InChIKey | ROFIOPBAOPAYON-BDAKNGLRSA-N |
| XLogP | 1.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |