C10H21NO3 — CID 140961196
propan-2-yl (3R)-3-hydroxy-2-(propan-2-ylamino)butanoate (PubChem CID 140961196) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is propan-2-yl (3R)-3-hydroxy-2-(propan-2-ylamino)butanoate.
| Compound Name | propan-2-yl (3R)-3-hydroxy-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 140961196 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | propan-2-yl (3R)-3-hydroxy-2-(propan-2-ylamino)butanoate |
| SMILES | CC(C)NC(C(=O)OC(C)C)[C@@H](C)O |
| InChI | InChI=1S/C10H21NO3/c1-6(2)11-9(8(5)12)10(13)14-7(3)4/h6-9,11-12H,1-5H3/t8-,9?/m1/s1 |
| InChIKey | PCMHRNVCIKJQNH-VEDVMXKPSA-N |
| XLogP | 0.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |