C16H32N2O4 — CID 101067350
dipropan-2-yl 2,3-bis(propan-2-ylamino)butanedioate (PubChem CID 101067350) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is dipropan-2-yl 2,3-bis(propan-2-ylamino)butanedioate.
| Compound Name | dipropan-2-yl 2,3-bis(propan-2-ylamino)butanedioate |
|---|---|
| PubChem CID | 101067350 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | dipropan-2-yl 2,3-bis(propan-2-ylamino)butanedioate |
| SMILES | CC(C)NC(C(=O)OC(C)C)C(NC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H32N2O4/c1-9(2)17-13(15(19)21-11(5)6)14(18-10(3)4)16(20)22-12(7)8/h9-14,17-18H,1-8H3 |
| InChIKey | BYSMLDQGZFWLBE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |