C14H23NO7 — CID 102516667
1-O,1-O-diethyl 2-O-propan-2-yl 2-acetamidoethane-1,1,2-tricarboxylate (PubChem CID 102516667) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1-O,1-O-diethyl 2-O-propan-2-yl 2-acetamidoethane-1,1,2-tricarboxylate.
| Compound Name | 1-O,1-O-diethyl 2-O-propan-2-yl 2-acetamidoethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 102516667 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-O,1-O-diethyl 2-O-propan-2-yl 2-acetamidoethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(NC(C)=O)C(=O)OC(C)C |
| InChI | InChI=1S/C14H23NO7/c1-6-20-12(17)10(13(18)21-7-2)11(15-9(5)16)14(19)22-8(3)4/h8,10-11H,6-7H2,1-5H3,(H,15,16) |
| InChIKey | ODWMUVJXAOKZHV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|