C12H22N2O4 — CID 175974322
ethyl (2R)-2-[[(2S)-2-acetamidopropanoyl]amino]-3-methylbutanoate (PubChem CID 175974322) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is ethyl (2R)-2-[[(2S)-2-acetamidopropanoyl]amino]-3-methylbutanoate.
| Compound Name | ethyl (2R)-2-[[(2S)-2-acetamidopropanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 175974322 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | ethyl (2R)-2-[[(2S)-2-acetamidopropanoyl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)[C@H](C)NC(C)=O)C(C)C |
| InChI | InChI=1S/C12H22N2O4/c1-6-18-12(17)10(7(2)3)14-11(16)8(4)13-9(5)15/h7-8,10H,6H2,1-5H3,(H,13,15)(H,14,16)/t8-,10+/m0/s1 |
| InChIKey | FUHRDPBPSTULBW-WCBMZHEXSA-N |
| XLogP | 0.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |