C11H21NO4 — CID 170194218
ethyl (2R)-2-[[(3S)-3-hydroxybutanoyl]amino]-3-methylbutanoate (PubChem CID 170194218) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is ethyl (2R)-2-[[(3S)-3-hydroxybutanoyl]amino]-3-methylbutanoate.
| Compound Name | ethyl (2R)-2-[[(3S)-3-hydroxybutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 170194218 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | ethyl (2R)-2-[[(3S)-3-hydroxybutanoyl]amino]-3-methylbutanoate |
| SMILES | CCOC(=O)[C@H](NC(=O)C[C@H](C)O)C(C)C |
| InChI | InChI=1S/C11H21NO4/c1-5-16-11(15)10(7(2)3)12-9(14)6-8(4)13/h7-8,10,13H,5-6H2,1-4H3,(H,12,14)/t8-,10+/m0/s1 |
| InChIKey | XQEVDHXRHRYMHG-WCBMZHEXSA-N |
| XLogP | 0.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |