C9H16N2O5 — CID 15838992
ethyl (2S)-3-methyl-2-[(2-nitroacetyl)amino]butanoate (PubChem CID 15838992) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is ethyl (2S)-3-methyl-2-[(2-nitroacetyl)amino]butanoate.
| Compound Name | ethyl (2S)-3-methyl-2-[(2-nitroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 15838992 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | ethyl (2S)-3-methyl-2-[(2-nitroacetyl)amino]butanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)C[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C9H16N2O5/c1-4-16-9(13)8(6(2)3)10-7(12)5-11(14)15/h6,8H,4-5H2,1-3H3,(H,10,12)/t8-/m0/s1 |
| InChIKey | BYFJYSLMRXCAMX-QMMMGPOBSA-N |
| XLogP | -0.03 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|