C12H18F3NO4 — CID 139712131
ethyl 3-methyl-2-[[(Z)-4,4,4-trifluoro-1-methoxy-1-oxobut-2-en-2-yl]amino]butanoate (PubChem CID 139712131) has the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. Its IUPAC name is ethyl 3-methyl-2-[[(Z)-4,4,4-trifluoro-1-methoxy-1-oxobut-2-en-2-yl]amino]butanoate.
| Compound Name | ethyl 3-methyl-2-[[(Z)-4,4,4-trifluoro-1-methoxy-1-oxobut-2-en-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 139712131 |
| Molecular Formula | C12H18F3NO4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 3-methyl-2-[[(Z)-4,4,4-trifluoro-1-methoxy-1-oxobut-2-en-2-yl]amino]butanoate |
| SMILES | CCOC(=O)C(N/C(=C\C(F)(F)F)C(=O)OC)C(C)C |
| InChI | InChI=1S/C12H18F3NO4/c1-5-20-11(18)9(7(2)3)16-8(10(17)19-4)6-12(13,14)15/h6-7,9,16H,5H2,1-4H3/b8-6- |
| InChIKey | QEONYSPYBWJZFZ-VURMDHGXSA-N |
| XLogP | 1.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|