C13H24N2O5 — CID 91709592
ethyl 2-[2-(ethoxycarbonylamino)propanoylamino]-3-methylbutanoate (PubChem CID 91709592) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is ethyl 2-[2-(ethoxycarbonylamino)propanoylamino]-3-methylbutanoate.
| Compound Name | ethyl 2-[2-(ethoxycarbonylamino)propanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 91709592 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | ethyl 2-[2-(ethoxycarbonylamino)propanoylamino]-3-methylbutanoate |
| SMILES | CCOC(=O)NC(C)C(=O)NC(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C13H24N2O5/c1-6-19-12(17)10(8(3)4)15-11(16)9(5)14-13(18)20-7-2/h8-10H,6-7H2,1-5H3,(H,14,18)(H,15,16) |
| InChIKey | NFJVVYQRIQENLM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |