C13H26N2O3 — CID 97029166
ethyl N-[(2S)-3-methyl-1-[[(2S)-3-methylbutan-2-yl]amino]-1-oxobutan-2-yl]carbamate (PubChem CID 97029166) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is ethyl N-[(2S)-3-methyl-1-[[(2S)-3-methylbutan-2-yl]amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-3-methyl-1-[[(2S)-3-methylbutan-2-yl]amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 97029166 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | ethyl N-[(2S)-3-methyl-1-[[(2S)-3-methylbutan-2-yl]amino]-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H](C(=O)N[C@@H](C)C(C)C)C(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-7-18-13(17)15-11(9(4)5)12(16)14-10(6)8(2)3/h8-11H,7H2,1-6H3,(H,14,16)(H,15,17)/t10-,11-/m0/s1 |
| InChIKey | BUTLYYRSBAFAIG-QWRGUYRKSA-N |
| XLogP | 1.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |