C13H28N4O5S — CID 119035476
ethyl N-[3-methyl-1-oxo-1-[2-(propan-2-ylsulfamoylamino)ethylamino]butan-2-yl]carbamate (PubChem CID 119035476) has the molecular formula C13H28N4O5S and a molecular weight of 352.46 g/mol. Its IUPAC name is ethyl N-[3-methyl-1-oxo-1-[2-(propan-2-ylsulfamoylamino)ethylamino]butan-2-yl]carbamate.
| Compound Name | ethyl N-[3-methyl-1-oxo-1-[2-(propan-2-ylsulfamoylamino)ethylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 119035476 |
| Molecular Formula | C13H28N4O5S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | ethyl N-[3-methyl-1-oxo-1-[2-(propan-2-ylsulfamoylamino)ethylamino]butan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C(=O)NCCNS(=O)(=O)NC(C)C)C(C)C |
| InChI | InChI=1S/C13H28N4O5S/c1-6-22-13(19)16-11(9(2)3)12(18)14-7-8-15-23(20,21)17-10(4)5/h9-11,15,17H,6-8H2,1-5H3,(H,14,18)(H,16,19) |
| InChIKey | DAOGICTVMPOTBV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|