C17H25FN2O4 — CID 46456848
ethyl N-[1-[3-(2-fluorophenoxy)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 46456848) has the molecular formula C17H25FN2O4 and a molecular weight of 340.40 g/mol. Its IUPAC name is ethyl N-[1-[3-(2-fluorophenoxy)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[3-(2-fluorophenoxy)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46456848 |
| Molecular Formula | C17H25FN2O4 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | ethyl N-[1-[3-(2-fluorophenoxy)propylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C(=O)NCCCOc1ccccc1F)C(C)C |
| InChI | InChI=1S/C17H25FN2O4/c1-4-23-17(22)20-15(12(2)3)16(21)19-10-7-11-24-14-9-6-5-8-13(14)18/h5-6,8-9,12,15H,4,7,10-11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | IOAAGRKERYPGQV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|