C12H16FN3O3 — CID 110482734
(2S)-2-amino-N-[2-(2-fluorophenoxy)ethyl]butanediamide (PubChem CID 110482734) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2-fluorophenoxy)ethyl]butanediamide.
| Compound Name | (2S)-2-amino-N-[2-(2-fluorophenoxy)ethyl]butanediamide |
|---|---|
| PubChem CID | 110482734 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (2S)-2-amino-N-[2-(2-fluorophenoxy)ethyl]butanediamide |
| SMILES | NC(=O)C[C@H](N)C(=O)NCCOc1ccccc1F |
| InChI | InChI=1S/C12H16FN3O3/c13-8-3-1-2-4-10(8)19-6-5-16-12(18)9(14)7-11(15)17/h1-4,9H,5-7,14H2,(H2,15,17)(H,16,18)/t9-/m0/s1 |
| InChIKey | KDIVDXHOCXVBMP-VIFPVBQESA-N |
| XLogP | -0.48 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|