C12H16FNO2 — CID 110478459
N-[2-(2-fluorophenoxy)ethyl]-2-methylpropanamide (PubChem CID 110478459) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-2-methylpropanamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110478459 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCOc1ccccc1F |
| InChI | InChI=1S/C12H16FNO2/c1-9(2)12(15)14-7-8-16-11-6-4-3-5-10(11)13/h3-6,9H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | AAJCWRIGSMXHKG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|