C13H18FNO3 — CID 54333211
tert-butyl N-[2-(2-fluorophenoxy)ethyl]carbamate (PubChem CID 54333211) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is tert-butyl N-[2-(2-fluorophenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-fluorophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 54333211 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | tert-butyl N-[2-(2-fluorophenoxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccccc1F |
| InChI | InChI=1S/C13H18FNO3/c1-13(2,3)18-12(16)15-8-9-17-11-7-5-4-6-10(11)14/h4-7H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | SZUBCQJYOYRADB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|