C15H23FN2O4 — CID 59174464
tert-butyl N-[2-[2-(4-amino-2-fluorophenoxy)ethoxy]ethyl]carbamate (PubChem CID 59174464) has the molecular formula C15H23FN2O4 and a molecular weight of 314.36 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(4-amino-2-fluorophenoxy)ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(4-amino-2-fluorophenoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 59174464 |
| Molecular Formula | C15H23FN2O4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | tert-butyl N-[2-[2-(4-amino-2-fluorophenoxy)ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOc1ccc(N)cc1F |
| InChI | InChI=1S/C15H23FN2O4/c1-15(2,3)22-14(19)18-6-7-20-8-9-21-13-5-4-11(17)10-12(13)16/h4-5,10H,6-9,17H2,1-3H3,(H,18,19) |
| InChIKey | LEBPHCALCOYWSA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|