C16H23FINO3 — CID 175150532
tert-butyl N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate (PubChem CID 175150532) has the molecular formula C16H23FINO3 and a molecular weight of 423.27 g/mol. Its IUPAC name is tert-butyl N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 175150532 |
| Molecular Formula | C16H23FINO3 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | tert-butyl N-[2-[3-fluoro-4-(3-iodopropoxy)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(OCCCI)c(F)c1 |
| InChI | InChI=1S/C16H23FINO3/c1-16(2,3)22-15(20)19-9-7-12-5-6-14(13(17)11-12)21-10-4-8-18/h5-6,11H,4,7-10H2,1-3H3,(H,19,20) |
| InChIKey | ZBGMCDJHFPWSJG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|