C20H34FNO4 — CID 176700845
tert-butyl N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;ethane (PubChem CID 176700845) has the molecular formula C20H34FNO4 and a molecular weight of 371.49 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 176700845 |
| Molecular Formula | C20H34FNO4 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | tert-butyl N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]carbamate;ethane |
| SMILES | CC.CC(C)c1ccc(F)cc1OCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28FNO4.C2H6/c1-13(2)15-7-6-14(19)12-16(15)23-11-10-22-9-8-20-17(21)24-18(3,4)5;1-2/h6-7,12-13H,8-11H2,1-5H3,(H,20,21);1-2H3 |
| InChIKey | LHSYRNSQALIJPZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|