C20H30FNO3 — CID 176701362
N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]-3,3-dimethylcyclobutane-1-carboxamide (PubChem CID 176701362) has the molecular formula C20H30FNO3 and a molecular weight of 351.46 g/mol. Its IUPAC name is N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]-3,3-dimethylcyclobutane-1-carboxamide.
| Compound Name | N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]-3,3-dimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 176701362 |
| Molecular Formula | C20H30FNO3 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]-3,3-dimethylcyclobutane-1-carboxamide |
| SMILES | CC(C)c1ccc(F)cc1OCCOCCNC(=O)C1CC(C)(C)C1 |
| InChI | InChI=1S/C20H30FNO3/c1-14(2)17-6-5-16(21)11-18(17)25-10-9-24-8-7-22-19(23)15-12-20(3,4)13-15/h5-6,11,14-15H,7-10,12-13H2,1-4H3,(H,22,23) |
| InChIKey | FLHBTDNTYRMEGB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|