C20H30F3NO3 — CID 176701242
3,3-difluoro-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]cyclobutane-1-carboxamide;ethane (PubChem CID 176701242) has the molecular formula C20H30F3NO3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3,3-difluoro-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]cyclobutane-1-carboxamide;ethane.
| Compound Name | 3,3-difluoro-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]cyclobutane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 176701242 |
| Molecular Formula | C20H30F3NO3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 3,3-difluoro-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]cyclobutane-1-carboxamide;ethane |
| SMILES | CC.CC(C)c1ccc(F)cc1OCCOCCNC(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C18H24F3NO3.C2H6/c1-12(2)15-4-3-14(19)9-16(15)25-8-7-24-6-5-22-17(23)13-10-18(20,21)11-13;1-2/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H,22,23);1-2H3 |
| InChIKey | ISIZFACLOANSQP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|