C21H30FNO2 — CID 176700331
N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]cyclohexanecarboxamide (PubChem CID 176700331) has the molecular formula C21H30FNO2 and a molecular weight of 347.47 g/mol. Its IUPAC name is N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 176700331 |
| Molecular Formula | C21H30FNO2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]cyclohexanecarboxamide |
| SMILES | CC(C)c1ccc(F)cc1OCC1CC(NC(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C21H30FNO2/c1-14(2)19-9-8-17(22)12-20(19)25-13-15-10-18(11-15)23-21(24)16-6-4-3-5-7-16/h8-9,12,14-16,18H,3-7,10-11,13H2,1-2H3,(H,23,24) |
| InChIKey | RUNLNRCOIMNIOD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |