C16H21ClFNO2 — CID 176700322
2-chloro-N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]acetamide (PubChem CID 176700322) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is 2-chloro-N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]acetamide.
| Compound Name | 2-chloro-N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]acetamide |
|---|---|
| PubChem CID | 176700322 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-chloro-N-[3-[(5-fluoro-2-propan-2-ylphenoxy)methyl]cyclobutyl]acetamide |
| SMILES | CC(C)c1ccc(F)cc1OCC1CC(NC(=O)CCl)C1 |
| InChI | InChI=1S/C16H21ClFNO2/c1-10(2)14-4-3-12(18)7-15(14)21-9-11-5-13(6-11)19-16(20)8-17/h3-4,7,10-11,13H,5-6,8-9H2,1-2H3,(H,19,20) |
| InChIKey | VCRUUXVUEYLYFL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|