C21H30ClFN2O4 — CID 176701492
1-(2-chloroacetyl)-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]piperidine-3-carboxamide (PubChem CID 176701492) has the molecular formula C21H30ClFN2O4 and a molecular weight of 428.93 g/mol. Its IUPAC name is 1-(2-chloroacetyl)-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(2-chloroacetyl)-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 176701492 |
| Molecular Formula | C21H30ClFN2O4 |
| Molecular Weight | 428.93 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-(2-chloroacetyl)-N-[2-[2-(5-fluoro-2-propan-2-ylphenoxy)ethoxy]ethyl]piperidine-3-carboxamide |
| SMILES | CC(C)c1ccc(F)cc1OCCOCCNC(=O)C1CCCN(C(=O)CCl)C1 |
| InChI | InChI=1S/C21H30ClFN2O4/c1-15(2)18-6-5-17(23)12-19(18)29-11-10-28-9-7-24-21(27)16-4-3-8-25(14-16)20(26)13-22/h5-6,12,15-16H,3-4,7-11,13-14H2,1-2H3,(H,24,27) |
| InChIKey | SPPWSNYGDPGZOA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|