C26H33FN2O5 — CID 55748663
1-[2-(4-fluorophenyl)acetyl]-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]piperidine-3-carboxamide (PubChem CID 55748663) has the molecular formula C26H33FN2O5 and a molecular weight of 472.56 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)acetyl]-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(4-fluorophenyl)acetyl]-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55748663 |
| Molecular Formula | C26H33FN2O5 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[2-(4-fluorophenyl)acetyl]-N-[1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]piperidine-3-carboxamide |
| SMILES | COCCOc1ccc(C(C)NC(=O)C2CCCN(C(=O)Cc3ccc(F)cc3)C2)cc1OC |
| InChI | InChI=1S/C26H33FN2O5/c1-18(20-8-11-23(24(16-20)33-3)34-14-13-32-2)28-26(31)21-5-4-12-29(17-21)25(30)15-19-6-9-22(27)10-7-19/h6-11,16,18,21H,4-5,12-15,17H2,1-3H3,(H,28,31) |
| InChIKey | JUYCXQUPGVJTDU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|